C27H34FN3O5 — CID 163226594
benzyl (2S)-4-[(dimethylamino)methyl]-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylate (PubChem CID 163226594) has the molecular formula C27H34FN3O5 and a molecular weight of 499.58 g/mol. Its IUPAC name is benzyl (2S)-4-[(dimethylamino)methyl]-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-4-[(dimethylamino)methyl]-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 163226594 |
| Molecular Formula | C27H34FN3O5 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | benzyl (2S)-4-[(dimethylamino)methyl]-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylate |
| SMILES | CN(C)CC1(F)C[C@@H](C(=O)OCc2ccccc2)N(C(=O)CNC(=O)CCCOc2ccccc2)C1 |
| InChI | InChI=1S/C27H34FN3O5/c1-30(2)19-27(28)16-23(26(34)36-18-21-10-5-3-6-11-21)31(20-27)25(33)17-29-24(32)14-9-15-35-22-12-7-4-8-13-22/h3-8,10-13,23H,9,14-20H2,1-2H3,(H,29,32)/t23-,27?/m0/s1 |
| InChIKey | CDCDISCJGDLKGE-DCCUJTHKSA-N |
| XLogP | 2.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|