C24H23N3O6 — CID 169198527
methyl (8S)-7-[2-(acridine-3-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate (PubChem CID 169198527) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is methyl (8S)-7-[2-(acridine-3-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate.
| Compound Name | methyl (8S)-7-[2-(acridine-3-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 169198527 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | methyl (8S)-7-[2-(acridine-3-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2(CN1C(=O)CNC(=O)c1ccc3cc4ccccc4nc3c1)OCCO2 |
| InChI | InChI=1S/C24H23N3O6/c1-31-23(30)20-12-24(32-8-9-33-24)14-27(20)21(28)13-25-22(29)17-7-6-16-10-15-4-2-3-5-18(15)26-19(16)11-17/h2-7,10-11,20H,8-9,12-14H2,1H3,(H,25,29)/t20-/m0/s1 |
| InChIKey | OUXYTFBGVXNHAC-FQEVSTJZSA-N |
| XLogP | 1.63 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|