C12H18N4O4S — CID 172823689
tert-butyl N-[2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamate (PubChem CID 172823689) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 172823689 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | tert-butyl N-[2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(N)=O)c1cc(C(N)=NO)cs1 |
| InChI | InChI=1S/C12H18N4O4S/c1-12(2,3)20-11(18)15-8(10(14)17)7-4-6(5-21-7)9(13)16-19/h4-5,8,19H,1-3H3,(H2,13,16)(H2,14,17)(H,15,18) |
| InChIKey | UOKNTKHCGMAGES-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|