C12H19N3O3S — CID 163225171
tert-butyl N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)-2-hydroxyethyl]carbamate (PubChem CID 163225171) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 163225171 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)-2-hydroxyethyl]carbamate |
| SMILES | [H]/N=C(\N)c1csc([C@@H](CO)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C12H19N3O3S/c1-12(2,3)18-11(17)15-8(5-16)9-4-7(6-19-9)10(13)14/h4,6,8,16H,5H2,1-3H3,(H3,13,14)(H,15,17)/t8-/m1/s1 |
| InChIKey | ZDQXUIJEKDABQA-MRVPVSSYSA-N |
| XLogP | 1.59 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|