C12H16N2O3S — CID 163225922
tert-butyl N-[(1S)-1-(4-cyanothiophen-2-yl)-2-hydroxyethyl]carbamate (PubChem CID 163225922) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-cyanothiophen-2-yl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-cyanothiophen-2-yl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 163225922 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-cyanothiophen-2-yl)-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)c1cc(C#N)cs1 |
| InChI | InChI=1S/C12H16N2O3S/c1-12(2,3)17-11(16)14-9(6-15)10-4-8(5-13)7-18-10/h4,7,9,15H,6H2,1-3H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | HKNZJJDINWMSIL-VIFPVBQESA-N |
| XLogP | 2.18 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |