C16H22N2O4 — CID 129196909
tert-butyl N-[(2R)-1-(4-cyano-2-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 129196909) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-cyano-2-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-cyano-2-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 129196909 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-cyano-2-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | COc1cc(C#N)ccc1C[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22N2O4/c1-16(2,3)22-15(20)18-13(10-19)8-12-6-5-11(9-17)7-14(12)21-4/h5-7,13,19H,8,10H2,1-4H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | IOFWNDIURYESRO-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |