C15H24N2O4 — CID 15529439
tert-butyl N-[(2S)-1-(2-amino-6-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 15529439) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-amino-6-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-amino-6-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15529439 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-amino-6-methoxyphenyl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | COc1cccc(N)c1C[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4/c1-15(2,3)21-14(19)17-10(9-18)8-11-12(16)6-5-7-13(11)20-4/h5-7,10,18H,8-9,16H2,1-4H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | LLEGGXCZJGFMKD-JTQLQIEISA-N |
| XLogP | 1.71 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|