C15H18N2O3 — CID 91126844
tert-butyl N-[1-(3-cyanophenyl)-3-oxopropyl]carbamate (PubChem CID 91126844) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl N-[1-(3-cyanophenyl)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-cyanophenyl)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 91126844 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | tert-butyl N-[1-(3-cyanophenyl)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-15(2,3)20-14(19)17-13(7-8-18)12-6-4-5-11(9-12)10-16/h4-6,8-9,13H,7H2,1-3H3,(H,17,19) |
| InChIKey | NBZFFMVOPFJPON-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|