C25H42N2O2Sn — CID 134944573
tert-butyl N-[(3-cyanophenyl)-tributylstannylmethyl]carbamate (PubChem CID 134944573) has the molecular formula C25H42N2O2Sn and a molecular weight of 521.33 g/mol. Its IUPAC name is tert-butyl N-[(3-cyanophenyl)-tributylstannylmethyl]carbamate.
| Compound Name | tert-butyl N-[(3-cyanophenyl)-tributylstannylmethyl]carbamate |
|---|---|
| PubChem CID | 134944573 |
| Molecular Formula | C25H42N2O2Sn |
| Molecular Weight | 521.33 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | tert-butyl N-[(3-cyanophenyl)-tributylstannylmethyl]carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(NC(=O)OC(C)(C)C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H15N2O2.3C4H9.Sn/c1-13(2,3)17-12(16)15-9-11-6-4-5-10(7-11)8-14;3*1-3-4-2;/h4-7,9H,1-3H3,(H,15,16);3*1,3-4H2,2H3; |
| InChIKey | YIRVOSMITXTRJD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.33 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |