C22H30N6O5 — CID 145150759
tert-butyl N-[2-butoxy-1-[5-[[(3-cyanophenyl)carbamoylamino]methyl]-1,2,4-oxadiazol-3-yl]ethyl]carbamate (PubChem CID 145150759) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is tert-butyl N-[2-butoxy-1-[5-[[(3-cyanophenyl)carbamoylamino]methyl]-1,2,4-oxadiazol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-butoxy-1-[5-[[(3-cyanophenyl)carbamoylamino]methyl]-1,2,4-oxadiazol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 145150759 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | tert-butyl N-[2-butoxy-1-[5-[[(3-cyanophenyl)carbamoylamino]methyl]-1,2,4-oxadiazol-3-yl]ethyl]carbamate |
| SMILES | CCCCOCC(NC(=O)OC(C)(C)C)c1noc(CNC(=O)Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C22H30N6O5/c1-5-6-10-31-14-17(26-21(30)32-22(2,3)4)19-27-18(33-28-19)13-24-20(29)25-16-9-7-8-15(11-16)12-23/h7-9,11,17H,5-6,10,13-14H2,1-4H3,(H,26,30)(H2,24,25,29) |
| InChIKey | GWUKDVWKZIEBMX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|