C15H18N2O4 — CID 57364503
(2S)-2-[amino-(3-cyanophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 57364503) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2S)-2-[amino-(3-cyanophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | (2S)-2-[amino-(3-cyanophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 57364503 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S)-2-[amino-(3-cyanophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](C(=O)O)C(N)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-14(20)11(13(18)19)12(17)10-6-4-5-9(7-10)8-16/h4-7,11-12H,17H2,1-3H3,(H,18,19)/t11-,12?/m0/s1 |
| InChIKey | BRGOAXZQFRADFX-PXYINDEMSA-N |
| XLogP | 1.60 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|