C15H21NO5 — CID 57363280
(2R)-2-[amino-(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 57363280) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2R)-2-[amino-(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | (2R)-2-[amino-(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 57363280 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2R)-2-[amino-(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | COc1ccc(C(N)[C@H](C(=O)O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(19)11(13(17)18)12(16)9-5-7-10(20-4)8-6-9/h5-8,11-12H,16H2,1-4H3,(H,17,18)/t11-,12?/m1/s1 |
| InChIKey | ACEUUWRDCLYJKG-JHJMLUEUSA-N |
| XLogP | 1.74 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|