C18H27NO5 — CID 174570665
ditert-butyl 2-[amino-(4-hydroxyphenyl)methyl]propanedioate (PubChem CID 174570665) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is ditert-butyl 2-[amino-(4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | ditert-butyl 2-[amino-(4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 174570665 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ditert-butyl 2-[amino-(4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)C(N)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H27NO5/c1-17(2,3)23-15(21)13(16(22)24-18(4,5)6)14(19)11-7-9-12(20)10-8-11/h7-10,13-14,20H,19H2,1-6H3 |
| InChIKey | AXHWQZUFTUSLKB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|