C14H19NO5 — CID 101086095
tert-butyl 2-[(2-hydroxyacetyl)amino]-2-(4-hydroxyphenyl)acetate (PubChem CID 101086095) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is tert-butyl 2-[(2-hydroxyacetyl)amino]-2-(4-hydroxyphenyl)acetate.
| Compound Name | tert-butyl 2-[(2-hydroxyacetyl)amino]-2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 101086095 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | tert-butyl 2-[(2-hydroxyacetyl)amino]-2-(4-hydroxyphenyl)acetate |
| SMILES | CC(C)(C)OC(=O)C(NC(=O)CO)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H19NO5/c1-14(2,3)20-13(19)12(15-11(18)8-16)9-4-6-10(17)7-5-9/h4-7,12,16-17H,8H2,1-3H3,(H,15,18) |
| InChIKey | ZFVCHRMFBSVATB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |