C17H24N2O3 — CID 70981207
tert-butyl N-[3-cyano-1-(3-ethoxyphenyl)propyl]carbamate (PubChem CID 70981207) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-[3-cyano-1-(3-ethoxyphenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-cyano-1-(3-ethoxyphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 70981207 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-[3-cyano-1-(3-ethoxyphenyl)propyl]carbamate |
| SMILES | CCOc1cccc(C(CCC#N)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-5-21-14-9-6-8-13(12-14)15(10-7-11-18)19-16(20)22-17(2,3)4/h6,8-9,12,15H,5,7,10H2,1-4H3,(H,19,20) |
| InChIKey | FGMWASJTZYGAAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |