C25H33N3O2 — CID 10692785
tert-butyl N-[3-[benzyl(3-cyanopropyl)amino]-1-phenylpropyl]carbamate (PubChem CID 10692785) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is tert-butyl N-[3-[benzyl(3-cyanopropyl)amino]-1-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[benzyl(3-cyanopropyl)amino]-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 10692785 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | tert-butyl N-[3-[benzyl(3-cyanopropyl)amino]-1-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCN(CCCC#N)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O2/c1-25(2,3)30-24(29)27-23(22-14-8-5-9-15-22)16-19-28(18-11-10-17-26)20-21-12-6-4-7-13-21/h4-9,12-15,23H,10-11,16,18-20H2,1-3H3,(H,27,29) |
| InChIKey | ZNWYAFQHVABPGF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|