C19H29N3O3 — CID 10617663
tert-butyl N-[3-[benzyl-[(2S)-3-cyano-2-hydroxypropyl]amino]propyl]carbamate (PubChem CID 10617663) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-[3-[benzyl-[(2S)-3-cyano-2-hydroxypropyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[benzyl-[(2S)-3-cyano-2-hydroxypropyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 10617663 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl N-[3-[benzyl-[(2S)-3-cyano-2-hydroxypropyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(Cc1ccccc1)C[C@@H](O)CC#N |
| InChI | InChI=1S/C19H29N3O3/c1-19(2,3)25-18(24)21-12-7-13-22(15-17(23)10-11-20)14-16-8-5-4-6-9-16/h4-6,8-9,17,23H,7,10,12-15H2,1-3H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | LCGUSPAZENQGTB-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|