C30H44N2O6 — CID 86698164
tert-butyl N-[2-[benzyl-[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]carbamate (PubChem CID 86698164) has the molecular formula C30H44N2O6 and a molecular weight of 528.69 g/mol. Its IUPAC name is tert-butyl N-[2-[benzyl-[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[benzyl-[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 86698164 |
| Molecular Formula | C30H44N2O6 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | tert-butyl N-[2-[benzyl-[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(Cc1ccccc1)CC(O)COc1ccc(OCCOC2CCCC2)cc1 |
| InChI | InChI=1S/C30H44N2O6/c1-30(2,3)38-29(34)31-17-18-32(21-24-9-5-4-6-10-24)22-25(33)23-37-28-15-13-27(14-16-28)36-20-19-35-26-11-7-8-12-26/h4-6,9-10,13-16,25-26,33H,7-8,11-12,17-23H2,1-3H3,(H,31,34) |
| InChIKey | QNLCQMDJKDALLT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|