C14H21NO5 — CID 10880575
tert-butyl N-(2-hydroxy-3-phenoxypropoxy)carbamate (PubChem CID 10880575) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-3-phenoxypropoxy)carbamate.
| Compound Name | tert-butyl N-(2-hydroxy-3-phenoxypropoxy)carbamate |
|---|---|
| PubChem CID | 10880575 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl N-(2-hydroxy-3-phenoxypropoxy)carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC(O)COc1ccccc1 |
| InChI | InChI=1S/C14H21NO5/c1-14(2,3)20-13(17)15-19-10-11(16)9-18-12-7-5-4-6-8-12/h4-8,11,16H,9-10H2,1-3H3,(H,15,17) |
| InChIKey | UEYLQEKAXZRFSN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|