C25H33FN2O5 — CID 56597590
N-[2-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-fluorobenzamide (PubChem CID 56597590) has the molecular formula C25H33FN2O5 and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[2-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 56597590 |
| Molecular Formula | C25H33FN2O5 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[2-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-fluorobenzamide |
| SMILES | O=C(NCCNCC(O)COc1ccc(OCCOC2CCCC2)cc1)c1ccccc1F |
| InChI | InChI=1S/C25H33FN2O5/c26-24-8-4-3-7-23(24)25(30)28-14-13-27-17-19(29)18-33-22-11-9-21(10-12-22)32-16-15-31-20-5-1-2-6-20/h3-4,7-12,19-20,27,29H,1-2,5-6,13-18H2,(H,28,30) |
| InChIKey | ARTCAADAEHMOQX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|