C26H36N2O5 — CID 56597316
4-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]-N-phenylbutanamide (PubChem CID 56597316) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 4-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]-N-phenylbutanamide.
| Compound Name | 4-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]-N-phenylbutanamide |
|---|---|
| PubChem CID | 56597316 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-[[3-[4-(2-cyclopentyloxyethoxy)phenoxy]-2-hydroxypropyl]amino]-N-phenylbutanamide |
| SMILES | O=C(CCCNCC(O)COc1ccc(OCCOC2CCCC2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C26H36N2O5/c29-22(19-27-16-6-11-26(30)28-21-7-2-1-3-8-21)20-33-25-14-12-24(13-15-25)32-18-17-31-23-9-4-5-10-23/h1-3,7-8,12-15,22-23,27,29H,4-6,9-11,16-20H2,(H,28,30) |
| InChIKey | VUXHYWHDZAVJKZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|