C13H19N3O2 — CID 130720350
tert-butyl N-(3-carbamimidoyl-5-methylphenyl)carbamate (PubChem CID 130720350) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is tert-butyl N-(3-carbamimidoyl-5-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(3-carbamimidoyl-5-methylphenyl)carbamate |
|---|---|
| PubChem CID | 130720350 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | tert-butyl N-(3-carbamimidoyl-5-methylphenyl)carbamate |
| SMILES | [H]/N=C(\N)c1cc(C)cc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C13H19N3O2/c1-8-5-9(11(14)15)7-10(6-8)16-12(17)18-13(2,3)4/h5-7H,1-4H3,(H3,14,15)(H,16,17) |
| InChIKey | KNHKBTHDFCKZLW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|