C15H15Br2ClN6O — CID 44522050
1,3-bis(3-bromo-5-carbamimidoylphenyl)urea;hydrochloride (PubChem CID 44522050) has the molecular formula C15H15Br2ClN6O and a molecular weight of 490.59 g/mol. Its IUPAC name is 1,3-bis(3-bromo-5-carbamimidoylphenyl)urea;hydrochloride.
| Compound Name | 1,3-bis(3-bromo-5-carbamimidoylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 44522050 |
| Molecular Formula | C15H15Br2ClN6O |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | 1,3-bis(3-bromo-5-carbamimidoylphenyl)urea;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cc(Br)cc(NC(=O)Nc2cc(Br)cc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C15H14Br2N6O.ClH/c16-9-1-7(13(18)19)3-11(5-9)22-15(24)23-12-4-8(14(20)21)2-10(17)6-12;/h1-6H,(H3,18,19)(H3,20,21)(H2,22,23,24);1H |
| InChIKey | RRQDUKLWFJFQDF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|