C7H16N4O2 — CID 87503014
tert-butyl N-(1,2-diamino-2-iminoethyl)carbamate (PubChem CID 87503014) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is tert-butyl N-(1,2-diamino-2-iminoethyl)carbamate.
| Compound Name | tert-butyl N-(1,2-diamino-2-iminoethyl)carbamate |
|---|---|
| PubChem CID | 87503014 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | tert-butyl N-(1,2-diamino-2-iminoethyl)carbamate |
| SMILES | [H]/N=C(\N)C(N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H16N4O2/c1-7(2,3)13-6(12)11-5(10)4(8)9/h5H,10H2,1-3H3,(H3,8,9)(H,11,12) |
| InChIKey | AKKDGYPVKONARF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|