C7H15N3O2 — CID 174596017
(4-amino-4-imino-2,3-dimethylbutan-2-yl) carbamate (PubChem CID 174596017) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is (4-amino-4-imino-2,3-dimethylbutan-2-yl) carbamate.
| Compound Name | (4-amino-4-imino-2,3-dimethylbutan-2-yl) carbamate |
|---|---|
| PubChem CID | 174596017 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (4-amino-4-imino-2,3-dimethylbutan-2-yl) carbamate |
| SMILES | [H]/N=C(\N)C(C)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C7H15N3O2/c1-4(5(8)9)7(2,3)12-6(10)11/h4H,1-3H3,(H3,8,9)(H2,10,11) |
| InChIKey | JWSWDJFCQDIMNY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|