C6H12N2O2 — CID 144873528
carbamoyl 2,2-dimethylpropanimidate (PubChem CID 144873528) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is carbamoyl 2,2-dimethylpropanimidate.
| Compound Name | carbamoyl 2,2-dimethylpropanimidate |
|---|---|
| PubChem CID | 144873528 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | carbamoyl 2,2-dimethylpropanimidate |
| SMILES | [H]/N=C(\OC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C6H12N2O2/c1-6(2,3)4(7)10-5(8)9/h7H,1-3H3,(H2,8,9)/b7-4- |
| InChIKey | IKSHLEFLQOEZTG-DAXSKMNVSA-N |
| XLogP | 1.11 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|