About carbamoyl carbamate;dihydrochloride
carbamoyl carbamate;dihydrochloride (PubChem CID 175326234) has the molecular formula C2H6Cl2N2O3
and a molecular weight of 176.99 g/mol. Its IUPAC name is carbamoyl carbamate;dihydrochloride.
Molecular Properties
| Compound Name | carbamoyl carbamate;dihydrochloride |
| PubChem CID | 175326234 |
| Molecular Formula | C2H6Cl2N2O3 |
| Molecular Weight | 176.99 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | carbamoyl carbamate;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)OC(N)=O |
| InChI | InChI=1S/C2H4N2O3.2ClH/c3-1(5)7-2(4)6;;/h(H2,3,5)(H2,4,6);2*1H |
| InChIKey | MPCIAEHOQGVPEF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.99 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl carbamate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl carbamate;dihydrochloride?
The IUPAC name of carbamoyl carbamate;dihydrochloride (CID 175326234) is carbamoyl carbamate;dihydrochloride.
What is the SMILES notation for carbamoyl carbamate;dihydrochloride?
The canonical SMILES for carbamoyl carbamate;dihydrochloride is Cl.Cl.NC(=O)OC(N)=O.
What is the InChIKey of carbamoyl carbamate;dihydrochloride?
The InChIKey is MPCIAEHOQGVPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2O3.2ClH/c3-1(5)7-2(4)6;;/h(H2,3,5)(H2,4,6);2*1H.
What are the key properties of carbamoyl carbamate;dihydrochloride?
carbamoyl carbamate;dihydrochloride has a molecular weight of 176.99 g/mol, XLogP of 0.00, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl carbamate;dihydrochloride is sourced from PubChem (CID 175326234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).