About carbamoyl fluoride;hydrochloride
carbamoyl fluoride;hydrochloride (PubChem CID 175206669) has the molecular formula CH3ClFNO
and a molecular weight of 99.49 g/mol. Its IUPAC name is carbamoyl fluoride;hydrochloride.
Molecular Properties
| Compound Name | carbamoyl fluoride;hydrochloride |
| PubChem CID | 175206669 |
| Molecular Formula | CH3ClFNO |
| Molecular Weight | 99.49 g/mol |
| Exact Mass | 98.99 |
| IUPAC Name | carbamoyl fluoride;hydrochloride |
| SMILES | Cl.NC(=O)F |
| InChI | InChI=1S/CH2FNO.ClH/c2-1(3)4;/h(H2,3,4);1H |
| InChIKey | RXOBLSOCGWESFU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl fluoride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl fluoride;hydrochloride?
The IUPAC name of carbamoyl fluoride;hydrochloride (CID 175206669) is carbamoyl fluoride;hydrochloride.
What is the SMILES notation for carbamoyl fluoride;hydrochloride?
The canonical SMILES for carbamoyl fluoride;hydrochloride is Cl.NC(=O)F.
What is the InChIKey of carbamoyl fluoride;hydrochloride?
The InChIKey is RXOBLSOCGWESFU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2FNO.ClH/c2-1(3)4;/h(H2,3,4);1H.
What are the key properties of carbamoyl fluoride;hydrochloride?
carbamoyl fluoride;hydrochloride has a molecular weight of 99.49 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl fluoride;hydrochloride is sourced from PubChem (CID 175206669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).