About formonitrile;urea;dihydrochloride
formonitrile;urea;dihydrochloride (PubChem CID 174786205) has the molecular formula C2H7Cl2N3O
and a molecular weight of 160.00 g/mol. Its IUPAC name is formonitrile;urea;dihydrochloride.
Molecular Properties
| Compound Name | formonitrile;urea;dihydrochloride |
| PubChem CID | 174786205 |
| Molecular Formula | C2H7Cl2N3O |
| Molecular Weight | 160.00 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | formonitrile;urea;dihydrochloride |
| SMILES | C#N.Cl.Cl.NC(N)=O |
| InChI | InChI=1S/CH4N2O.CHN.2ClH/c2-1(3)4;1-2;;/h(H4,2,3,4);1H;2*1H |
| InChIKey | SLGACHJMKAPSMW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.00 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze formonitrile;urea;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;urea;dihydrochloride?
The IUPAC name of formonitrile;urea;dihydrochloride (CID 174786205) is formonitrile;urea;dihydrochloride.
What is the SMILES notation for formonitrile;urea;dihydrochloride?
The canonical SMILES for formonitrile;urea;dihydrochloride is C#N.Cl.Cl.NC(N)=O.
What is the InChIKey of formonitrile;urea;dihydrochloride?
The InChIKey is SLGACHJMKAPSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.CHN.2ClH/c2-1(3)4;1-2;;/h(H4,2,3,4);1H;2*1H.
What are the key properties of formonitrile;urea;dihydrochloride?
formonitrile;urea;dihydrochloride has a molecular weight of 160.00 g/mol, XLogP of 0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;urea;dihydrochloride is sourced from PubChem (CID 174786205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).