C9H14Cl3N3O3 — CID 123394028
[N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl] 2,2-dimethylpropanimidate (PubChem CID 123394028) has the molecular formula C9H14Cl3N3O3 and a molecular weight of 318.59 g/mol. Its IUPAC name is [N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl] 2,2-dimethylpropanimidate.
| Compound Name | [N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl] 2,2-dimethylpropanimidate |
|---|---|
| PubChem CID | 123394028 |
| Molecular Formula | C9H14Cl3N3O3 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl] 2,2-dimethylpropanimidate |
| SMILES | [H]/N=C(\OC(N)=NC(=O)OCC(Cl)(Cl)Cl)C(C)(C)C |
| InChI | InChI=1S/C9H14Cl3N3O3/c1-8(2,3)5(13)18-6(14)15-7(16)17-4-9(10,11)12/h13H,4H2,1-3H3,(H2,14,15,16)/b13-5- |
| InChIKey | HZZYWIWGYVEAGV-ACAGNQJTSA-N |
| XLogP | 2.85 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|