C10H21ClN2O2 — CID 174605763
[(4R)-4-methanimidoyl-2,3-dimethylhexan-2-yl] carbamate;hydrochloride (PubChem CID 174605763) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is [(4R)-4-methanimidoyl-2,3-dimethylhexan-2-yl] carbamate;hydrochloride.
| Compound Name | [(4R)-4-methanimidoyl-2,3-dimethylhexan-2-yl] carbamate;hydrochloride |
|---|---|
| PubChem CID | 174605763 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | [(4R)-4-methanimidoyl-2,3-dimethylhexan-2-yl] carbamate;hydrochloride |
| SMILES | Cl.[H]/N=C/[C@H](CC)C(C)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-5-8(6-11)7(2)10(3,4)14-9(12)13;/h6-8,11H,5H2,1-4H3,(H2,12,13);1H/b11-6+;/t7?,8-;/m0./s1 |
| InChIKey | CABQPCPDKCNCGM-LZIQTSMGSA-N |
| XLogP | 2.59 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|