C11H24ClN3O2 — CID 137320121
tert-butyl N-(1-amino-1-imino-3-methylpentan-2-yl)carbamate;hydrochloride (PubChem CID 137320121) has the molecular formula C11H24ClN3O2 and a molecular weight of 265.78 g/mol. Its IUPAC name is tert-butyl N-(1-amino-1-imino-3-methylpentan-2-yl)carbamate;hydrochloride.
| Compound Name | tert-butyl N-(1-amino-1-imino-3-methylpentan-2-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 137320121 |
| Molecular Formula | C11H24ClN3O2 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | tert-butyl N-(1-amino-1-imino-3-methylpentan-2-yl)carbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(NC(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C11H23N3O2.ClH/c1-6-7(2)8(9(12)13)14-10(15)16-11(3,4)5;/h7-8H,6H2,1-5H3,(H3,12,13)(H,14,15);1H |
| InChIKey | VXBUJTDTEFXVRG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|