C11H23N3O2 — CID 61428279
tert-butyl N-(1-amino-1-imino-4-methylpentan-2-yl)carbamate (PubChem CID 61428279) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-(1-amino-1-imino-4-methylpentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-1-imino-4-methylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 61428279 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | tert-butyl N-(1-amino-1-imino-4-methylpentan-2-yl)carbamate |
| SMILES | [H]/N=C(\N)C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23N3O2/c1-7(2)6-8(9(12)13)14-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H3,12,13)(H,14,15) |
| InChIKey | CWTWRBZROUUNLF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|