C13H21N3O2S2 — CID 174056632
tert-butyl-[[(R)-cyclopropyl-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]amino]-oxidosulfanium (PubChem CID 174056632) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is tert-butyl-[[(R)-cyclopropyl-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(R)-cyclopropyl-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174056632 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | tert-butyl-[[(R)-cyclopropyl-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](c1cc(C(N)=NO)cs1)C1CC1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-13(2,3)20(18)16-11(8-4-5-8)10-6-9(7-19-10)12(14)15-17/h6-8,11,16-17H,4-5H2,1-3H3,(H2,14,15)/t11-,20?/m1/s1 |
| InChIKey | KJOAIYATORERKA-UAPALYRASA-N |
| XLogP | 2.35 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|