C8H13N3S — CID 163225802
N'-methyl-5-(methylaminomethyl)thiophene-3-carboximidamide (PubChem CID 163225802) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N'-methyl-5-(methylaminomethyl)thiophene-3-carboximidamide.
| Compound Name | N'-methyl-5-(methylaminomethyl)thiophene-3-carboximidamide |
|---|---|
| PubChem CID | 163225802 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N'-methyl-5-(methylaminomethyl)thiophene-3-carboximidamide |
| SMILES | C/N=C(\N)c1csc(CNC)c1 |
| InChI | InChI=1S/C8H13N3S/c1-10-4-7-3-6(5-12-7)8(9)11-2/h3,5,10H,4H2,1-2H3,(H2,9,11) |
| InChIKey | QCYPUJUICCBXMI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|