C10H18N2O2S2 — CID 142231695
ethane;5-(methylaminomethyl)-N-methylsulfinylthiophene-3-carboxamide (PubChem CID 142231695) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is ethane;5-(methylaminomethyl)-N-methylsulfinylthiophene-3-carboxamide.
| Compound Name | ethane;5-(methylaminomethyl)-N-methylsulfinylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 142231695 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethane;5-(methylaminomethyl)-N-methylsulfinylthiophene-3-carboxamide |
| SMILES | CC.CNCc1cc(C(=O)NS(C)=O)cs1 |
| InChI | InChI=1S/C8H12N2O2S2.C2H6/c1-9-4-7-3-6(5-13-7)8(11)10-14(2)12;1-2/h3,5,9H,4H2,1-2H3,(H,10,11);1-2H3 |
| InChIKey | ODZPEMLSAAREBE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |