C12H7F4NO2S — CID 107643616
5-[(2,3,5,6-tetrafluoroanilino)methyl]thiophene-3-carboxylic acid (PubChem CID 107643616) has the molecular formula C12H7F4NO2S and a molecular weight of 305.25 g/mol. Its IUPAC name is 5-[(2,3,5,6-tetrafluoroanilino)methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[(2,3,5,6-tetrafluoroanilino)methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 107643616 |
| Molecular Formula | C12H7F4NO2S |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-[(2,3,5,6-tetrafluoroanilino)methyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(CNc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C12H7F4NO2S/c13-7-2-8(14)10(16)11(9(7)15)17-3-6-1-5(4-20-6)12(18)19/h1-2,4,17H,3H2,(H,18,19) |
| InChIKey | ORZRKUJOOIZWCH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|