C12H7F4NO3 — CID 107644110
5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid (PubChem CID 107644110) has the molecular formula C12H7F4NO3 and a molecular weight of 289.18 g/mol. Its IUPAC name is 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107644110 |
| Molecular Formula | C12H7F4NO3 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C12H7F4NO3/c13-6-3-7(14)10(16)11(9(6)15)17-4-5-1-2-8(20-5)12(18)19/h1-3,17H,4H2,(H,18,19) |
| InChIKey | SUJMNYSAGVXVHL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|