5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid

C12H7F4NO3 — CID 107644110

IUPAC5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid
SMILESO=C(O)c1ccc(CNc2c(F)c(F)cc(F)c2F)o1
InChIInChI=1S/C12H7F4NO3/c13-6-3-7(14)10(16)11(9(6)15)17-4-5-1-2-8(20-5)12(18)19/h1-3,17H,4H2,(H,18,19)
InChIKeySUJMNYSAGVXVHL-UHFFFAOYSA-N
MW289.18 g/mol
LogP3.15
Rot. Bonds4

About 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid

5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid (PubChem CID 107644110) has the molecular formula C12H7F4NO3 and a molecular weight of 289.18 g/mol. Its IUPAC name is 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid.

Molecular Properties

Compound Name5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid
PubChem CID107644110
Molecular FormulaC12H7F4NO3
Molecular Weight289.18 g/mol
Exact Mass289.04
IUPAC Name5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid
SMILESO=C(O)c1ccc(CNc2c(F)c(F)cc(F)c2F)o1
InChIInChI=1S/C12H7F4NO3/c13-6-3-7(14)10(16)11(9(6)15)17-4-5-1-2-8(20-5)12(18)19/h1-3,17H,4H2,(H,18,19)
InChIKeySUJMNYSAGVXVHL-UHFFFAOYSA-N
XLogP3.15
TPSA62.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.18
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid (CID 107644110) is 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid is O=C(O)c1ccc(CNc2c(F)c(F)cc(F)c2F)o1.
What is the InChIKey of 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid?
The InChIKey is SUJMNYSAGVXVHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F4NO3/c13-6-3-7(14)10(16)11(9(6)15)17-4-5-1-2-8(20-5)12(18)19/h1-3,17H,4H2,(H,18,19).
What are the key properties of 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid?
5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid has a molecular weight of 289.18 g/mol, XLogP of 3.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-carboxylic acid is sourced from PubChem (CID 107644110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).