C12H9F4NO2 — CID 107643965
[5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-yl]methanol (PubChem CID 107643965) has the molecular formula C12H9F4NO2 and a molecular weight of 275.20 g/mol. Its IUPAC name is [5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 107643965 |
| Molecular Formula | C12H9F4NO2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CNc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C12H9F4NO2/c13-8-3-9(14)11(16)12(10(8)15)17-4-6-1-2-7(5-18)19-6/h1-3,17-18H,4-5H2 |
| InChIKey | UOLFDNROCZQWCA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|