C11H5F5INO — CID 115564209
2,3,4,5,6-pentafluoro-N-[(5-iodofuran-2-yl)methyl]aniline (PubChem CID 115564209) has the molecular formula C11H5F5INO and a molecular weight of 389.06 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(5-iodofuran-2-yl)methyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(5-iodofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 115564209 |
| Molecular Formula | C11H5F5INO |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(5-iodofuran-2-yl)methyl]aniline |
| SMILES | Fc1c(F)c(F)c(NCc2ccc(I)o2)c(F)c1F |
| InChI | InChI=1S/C11H5F5INO/c12-6-7(13)9(15)11(10(16)8(6)14)18-3-4-1-2-5(17)19-4/h1-2,18H,3H2 |
| InChIKey | DVNQAYRBSHBISE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|