C11H7Br2ClINO — CID 114208979
2,6-dibromo-4-chloro-N-[(5-iodofuran-2-yl)methyl]aniline (PubChem CID 114208979) has the molecular formula C11H7Br2ClINO and a molecular weight of 491.35 g/mol. Its IUPAC name is 2,6-dibromo-4-chloro-N-[(5-iodofuran-2-yl)methyl]aniline.
| Compound Name | 2,6-dibromo-4-chloro-N-[(5-iodofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 114208979 |
| Molecular Formula | C11H7Br2ClINO |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 488.76 |
| IUPAC Name | 2,6-dibromo-4-chloro-N-[(5-iodofuran-2-yl)methyl]aniline |
| SMILES | Clc1cc(Br)c(NCc2ccc(I)o2)c(Br)c1 |
| InChI | InChI=1S/C11H7Br2ClINO/c12-8-3-6(14)4-9(13)11(8)16-5-7-1-2-10(15)17-7/h1-4,16H,5H2 |
| InChIKey | LFGQUBIRNCAPIN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|