C11H8Cl2INO — CID 43772168
2,3-dichloro-N-[(5-iodofuran-2-yl)methyl]aniline (PubChem CID 43772168) has the molecular formula C11H8Cl2INO and a molecular weight of 368.00 g/mol. Its IUPAC name is 2,3-dichloro-N-[(5-iodofuran-2-yl)methyl]aniline.
| Compound Name | 2,3-dichloro-N-[(5-iodofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43772168 |
| Molecular Formula | C11H8Cl2INO |
| Molecular Weight | 368.00 g/mol |
| Exact Mass | 366.90 |
| IUPAC Name | 2,3-dichloro-N-[(5-iodofuran-2-yl)methyl]aniline |
| SMILES | Clc1cccc(NCc2ccc(I)o2)c1Cl |
| InChI | InChI=1S/C11H8Cl2INO/c12-8-2-1-3-9(11(8)13)15-6-7-4-5-10(14)16-7/h1-5,15H,6H2 |
| InChIKey | UYPYVTSSMZOAGR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.00 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|