C11H7BrF2INO — CID 65469111
4-bromo-2,6-difluoro-N-[(5-iodofuran-2-yl)methyl]aniline (PubChem CID 65469111) has the molecular formula C11H7BrF2INO and a molecular weight of 413.99 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-[(5-iodofuran-2-yl)methyl]aniline.
| Compound Name | 4-bromo-2,6-difluoro-N-[(5-iodofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 65469111 |
| Molecular Formula | C11H7BrF2INO |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 412.87 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-[(5-iodofuran-2-yl)methyl]aniline |
| SMILES | Fc1cc(Br)cc(F)c1NCc1ccc(I)o1 |
| InChI | InChI=1S/C11H7BrF2INO/c12-6-3-8(13)11(9(14)4-6)16-5-7-1-2-10(15)17-7/h1-4,16H,5H2 |
| InChIKey | MUOHYLUWPWQUSV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|