C13H10BrF2NO — CID 65468718
2-[(4-bromo-2,6-difluoroanilino)methyl]phenol (PubChem CID 65468718) has the molecular formula C13H10BrF2NO and a molecular weight of 314.13 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-difluoroanilino)methyl]phenol.
| Compound Name | 2-[(4-bromo-2,6-difluoroanilino)methyl]phenol |
|---|---|
| PubChem CID | 65468718 |
| Molecular Formula | C13H10BrF2NO |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-[(4-bromo-2,6-difluoroanilino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H10BrF2NO/c14-9-5-10(15)13(11(16)6-9)17-7-8-3-1-2-4-12(8)18/h1-6,17-18H,7H2 |
| InChIKey | REEPEKCSNAORMB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|