C13H9ClF5NO — CID 44657879
2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol;hydrochloride (PubChem CID 44657879) has the molecular formula C13H9ClF5NO and a molecular weight of 325.66 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol;hydrochloride.
| Compound Name | 2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 44657879 |
| Molecular Formula | C13H9ClF5NO |
| Molecular Weight | 325.66 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccccc1CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO.ClH/c14-8-9(15)11(17)13(12(18)10(8)16)19-5-6-3-1-2-4-7(6)20;/h1-4,19-20H,5H2;1H |
| InChIKey | HOVKKAHNTPJZQL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|