C13H7ClF5NO — CID 115564169
3-chloro-2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol (PubChem CID 115564169) has the molecular formula C13H7ClF5NO and a molecular weight of 323.65 g/mol. Its IUPAC name is 3-chloro-2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol.
| Compound Name | 3-chloro-2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol |
|---|---|
| PubChem CID | 115564169 |
| Molecular Formula | C13H7ClF5NO |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-chloro-2-[(2,3,4,5,6-pentafluoroanilino)methyl]phenol |
| SMILES | Oc1cccc(Cl)c1CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H7ClF5NO/c14-6-2-1-3-7(21)5(6)4-20-13-11(18)9(16)8(15)10(17)12(13)19/h1-3,20-21H,4H2 |
| InChIKey | GWTVZBPCUIZKGA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|