C13H9BrCl3NO — CID 107788099
2-[(4-bromo-2,3-dichloroanilino)methyl]-3-chlorophenol (PubChem CID 107788099) has the molecular formula C13H9BrCl3NO and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[(4-bromo-2,3-dichloroanilino)methyl]-3-chlorophenol.
| Compound Name | 2-[(4-bromo-2,3-dichloroanilino)methyl]-3-chlorophenol |
|---|---|
| PubChem CID | 107788099 |
| Molecular Formula | C13H9BrCl3NO |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 378.89 |
| IUPAC Name | 2-[(4-bromo-2,3-dichloroanilino)methyl]-3-chlorophenol |
| SMILES | Oc1cccc(Cl)c1CNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C13H9BrCl3NO/c14-8-4-5-10(13(17)12(8)16)18-6-7-9(15)2-1-3-11(7)19/h1-5,18-19H,6H2 |
| InChIKey | HJJXXYUWWIIMHZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|