C13H10F4N2 — CID 107643970
N-[(2-aminophenyl)methyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107643970) has the molecular formula C13H10F4N2 and a molecular weight of 270.23 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[(2-aminophenyl)methyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643970 |
| Molecular Formula | C13H10F4N2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | Nc1ccccc1CNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H10F4N2/c14-8-5-9(15)12(17)13(11(8)16)19-6-7-3-1-2-4-10(7)18/h1-5,19H,6,18H2 |
| InChIKey | KGMQYBLUQKYOHI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|