C13H9F4NO3 — CID 107644134
methyl 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-3-carboxylate (PubChem CID 107644134) has the molecular formula C13H9F4NO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is methyl 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 107644134 |
| Molecular Formula | C13H9F4NO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | methyl 5-[(2,3,5,6-tetrafluoroanilino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C13H9F4NO3/c1-20-13(19)6-2-7(21-5-6)4-18-12-10(16)8(14)3-9(15)11(12)17/h2-3,5,18H,4H2,1H3 |
| InChIKey | FWNNDXCYANMIMD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|