C12H11Br2NO2 — CID 64579776
[5-[(2,4-dibromoanilino)methyl]furan-2-yl]methanol (PubChem CID 64579776) has the molecular formula C12H11Br2NO2 and a molecular weight of 361.03 g/mol. Its IUPAC name is [5-[(2,4-dibromoanilino)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(2,4-dibromoanilino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64579776 |
| Molecular Formula | C12H11Br2NO2 |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 358.92 |
| IUPAC Name | [5-[(2,4-dibromoanilino)methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CNc2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C12H11Br2NO2/c13-8-1-4-12(11(14)5-8)15-6-9-2-3-10(7-16)17-9/h1-5,15-16H,6-7H2 |
| InChIKey | FKQYPCFASKRJOO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |